ChemNet > CAS > 266312-58-7 5-(2,4-dichlorophenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol
266312-58-7 5-(2,4-dichlorophenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol
| product Name |
5-(2,4-dichlorophenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol |
| CAS No |
266312-58-7 |
| Synonyms |
5-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| Molecular Formula |
C13H9Cl2N3OS |
| Molecular Weight |
326.2011 |
| InChI |
InChI=1/C13H9Cl2N3OS/c14-8-3-4-10(11(15)6-8)12-16-17-13(20)18(12)7-9-2-1-5-19-9/h1-6H,7H2,(H,17,20) |
| Molecular Structure |
|
| Density |
1.55g/cm3 |
| Melting point |
158℃ |
| Boiling point |
426.3°C at 760 mmHg |
| Refractive index |
1.716 |
| Flash point |
211.6°C |
| Vapour Pressur |
1.79E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
