ChemNet > CAS > 26650-75-9 2,4-Dichloro-6-n-propoxy-1,3,5-triazine
26650-75-9 2,4-Dichloro-6-n-propoxy-1,3,5-triazine
| product Name |
2,4-Dichloro-6-n-propoxy-1,3,5-triazine |
| CAS No |
26650-75-9 |
| Synonyms |
2,4-Dichloro-n-propoxy-s-triazine~n-Propoxydichloro-s-triazine; 2,4-dichloro-6-propoxy-1,3,5-triazine |
| Molecular Formula |
C6H7Cl2N3O |
| Molecular Weight |
208.0453 |
| InChI |
InChI=1/C6H7Cl2N3O/c1-2-3-12-6-10-4(7)9-5(8)11-6/h2-3H2,1H3 |
| EINECS |
247-875-7 |
| Molecular Structure |
|
| Density |
1.386g/cm3 |
| Boiling point |
348.1°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
164.3°C |
| Vapour Pressur |
0.000104mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
