ChemNet > CAS > 26663-77-4 methyl 1H-benzimidazole-5-carboxylate
26663-77-4 methyl 1H-benzimidazole-5-carboxylate
| product Name |
methyl 1H-benzimidazole-5-carboxylate |
| CAS No |
26663-77-4 |
| Synonyms |
1H-Benzimidazole-5-carboxylic acid methyl ester; methyl 1H-benzimidazole-6-carboxylate |
| Molecular Formula |
C9H8N2O2 |
| Molecular Weight |
176.172 |
| InChI |
InChI=1/C9H8N2O2/c1-13-9(12)6-2-3-7-8(4-6)11-5-10-7/h2-5H,1H3,(H,10,11) |
| Molecular Structure |
|
| Density |
1.324g/cm3 |
| Boiling point |
416.2°C at 760 mmHg |
| Refractive index |
1.648 |
| Flash point |
205.5°C |
| Vapour Pressur |
3.9E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
