ChemNet > CAS > 2670-38-4 3,4-Dichlorobenzamide
2670-38-4 3,4-Dichlorobenzamide
| product Name |
3,4-Dichlorobenzamide |
| CAS No |
2670-38-4 |
| Molecular Formula |
C7H5Cl2NO |
| Molecular Weight |
190.0267 |
| InChI |
InChI=1/C7H5Cl2NO/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H2,10,11) |
| Molecular Structure |
|
| Density |
1.439g/cm3 |
| Melting point |
140℃ |
| Boiling point |
281.2°C at 760 mmHg |
| Refractive index |
1.596 |
| Flash point |
123.9°C |
| Vapour Pressur |
0.00361mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
