ChemNet > CAS > 26739-53-7 Guanidine stearate
26739-53-7 Guanidine stearate
| product Name |
Guanidine stearate |
| Synonyms |
Octadecanoic acid, compd. with guanidine (1:1); Stearic acid, compound with guanidine (1:1); octadecanoic acid - guanidine (1:1) |
| Molecular Formula |
C19H41N3O2 |
| Molecular Weight |
343.5477 |
| InChI |
InChI=1/C18H36O2.CH5N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4/h2-17H2,1H3,(H,19,20);(H5,2,3,4) |
| CAS Registry Number |
26739-53-7 |
| EINECS |
247-950-4 |
| Molecular Structure |
|
| Boiling point |
359.4°C at 760 mmHg |
| Flash point |
162.4°C |
| Vapour Pressur |
8.58E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
