26964-24-9 6-Methoxyflavone
| product Name |
6-Methoxyflavone |
| CAS No |
26964-24-9 |
| Synonyms |
5-18-02-00257 (Beilstein Handbook Reference); 6-Methoxy-2-phenyl-4H-1-benzopyran-4-one; BRN 0218520; 4H-1-Benzopyran-4-one, 6-methoxy-2-phenyl-; 6-Methoxy-2-phenyl-4-benzopyrone; Flavone, 6-methoxy- (7CI,8CI); 6-methoxy-2-phenyl-4H-chromen-4-one |
| Molecular Formula |
C16H12O3 |
| Molecular Weight |
252.2647 |
| InChI |
InChI=1/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3 |
| EINECS |
248-144-5 |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Melting point |
163-165℃ |
| Boiling point |
421.2°C at 760 mmHg |
| Refractive index |
1.614 |
| Flash point |
200.3°C |
| Vapour Pressur |
2.66E-07mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|