ChemNet > CAS > 2708-77-2 4-fluoroglutamic acid
2708-77-2 4-fluoroglutamic acid
| product Name |
4-fluoroglutamic acid |
| CAS No |
2708-77-2 |
| Synonyms |
4-Fluoro-DL-glutamic acid; DL-4-Fluoroglutamic acid; H-4-F-DL-Glu-OH; 4-fluoro-L-glutamic acid |
| Molecular Formula |
C5H8FNO4 |
| Molecular Weight |
165.1197 |
| InChI |
InChI=1/C5H8FNO4/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)/t2?,3-/m0/s1 |
| EINECS |
220-302-8 |
| Molecular Structure |
|
| Density |
1.498g/cm3 |
| Boiling point |
342.4°C at 760 mmHg |
| Refractive index |
1.491 |
| Flash point |
160.9°C |
| Vapour Pressur |
1.37E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
