ChemNet > CAS > 271-58-9 2,1-Benzisoxazole
271-58-9 2,1-Benzisoxazole
| product Name |
2,1-Benzisoxazole |
| CAS No |
271-58-9 |
| Molecular Formula |
C7H5NO |
| Molecular Weight |
119.1207 |
| InChI |
InChI=1/C7H5NO/c1-2-4-7-6(3-1)5-9-8-7/h1-5H |
| EINECS |
205-980-5 |
| Molecular Structure |
|
| Density |
1.196g/cm3 |
| Boiling point |
215°C at 760 mmHg |
| Refractive index |
1.609 |
| Flash point |
93.9°C |
| Vapour Pressur |
0.221mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
