ChemNet > CAS > 2719-08-6 Methyl 2-acetamidobenzoate
2719-08-6 Methyl 2-acetamidobenzoate
| product Name |
Methyl 2-acetamidobenzoate |
| CAS No |
2719-08-6 |
| Synonyms |
methyl 2-(acetylamino)benzoate; Methyl N-acetylanthranilate; ACETYL-N-METHYL-ANTHRANILATE |
| Molecular Formula |
C10H11NO3 |
| Molecular Weight |
193.1992 |
| InChI |
InChI=1/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
| EINECS |
220-318-5 |
| Molecular Structure |
|
| Density |
1.204g/cm3 |
| Melting point |
97-101℃ |
| Boiling point |
376.3°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
181.4°C |
| Vapour Pressur |
7.3E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
