ChemNet > CAS > 2719-21-3 4-Acetamido-acetophenone
2719-21-3 4-Acetamido-acetophenone
| product Name |
4-Acetamido-acetophenone |
| CAS No |
2719-21-3 |
| Synonyms |
4-Acetylacetanilide~N,4-Diacetylaniline; 4-Acetamidoacetophenone; N-(4-acetylphenyl)acetamide |
| Molecular Formula |
C10H11NO2 |
| Molecular Weight |
177.1998 |
| InChI |
InChI=1/C10H11NO2/c1-7(12)9-3-5-10(6-4-9)11-8(2)13/h3-6H,1-2H3,(H,11,13) |
| EINECS |
220-320-6 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Melting point |
164-166℃ |
| Boiling point |
390.3°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
177.3°C |
| Vapour Pressur |
2.67E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
