ChemNet > CAS > 27193-86-8 4-Dodecylphenol, mixture of isomers
27193-86-8 4-Dodecylphenol, mixture of isomers
| product Name |
4-Dodecylphenol, mixture of isomers |
| CAS No |
27193-86-8 |
| Synonyms |
Dodecylphenol, mixture of isomers; 2-dodecylphenol |
| Molecular Formula |
C18H30O |
| Molecular Weight |
262.4302 |
| InChI |
InChI=1/C18H30O/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19/h12-13,15-16,19H,2-11,14H2,1H3 |
| EINECS |
248-312-8 |
| Molecular Structure |
|
| Density |
0.918g/cm3 |
| Boiling point |
368.3°C at 760 mmHg |
| Refractive index |
1.499 |
| Flash point |
210.8°C |
| Vapour Pressur |
6.05E-06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
