ChemNet > CAS > 27215-38-9 lauric acid, monoester with glycerol
27215-38-9 lauric acid, monoester with glycerol
| product Name |
lauric acid, monoester with glycerol |
| CAS No |
27215-38-9 |
| Synonyms |
Dodecanoic acid, monoester with 1,2,3-propanetriol; Glyceryl laurate; AI3-03482; Aldo MLD; Aldo MLD-K-FG; Cithrol GML; Dimodan ML 90; Glycerin monolaurate; Glycerol monolaurate (VAN); Glycerox L 8; Glyceryl monolaurate; Grindtek ML 90; Imwitor 312; Lauric acid monoglyceride; Lauricidin 802; Lauricidin 812; Lauricidin R; M 300; Monododecanoyl glycerol; Monoglycerol laurate; Monolauroylglycerin; Monomuls 90L12; Monomuls L 90; NSC 4837; Poem M 300; Sunsoft 750; Sunsoft 757; Tegin L 90; UNII-Y98611C087; Laurin, mono- (8CI); dodecanoic acid - propane-1,2,3-triol (1:1) |
| Molecular Formula |
C15H32O5 |
| Molecular Weight |
292.4116 |
| InChI |
InChI=1/C12H24O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;4-1-3(6)2-5/h2-11H2,1H3,(H,13,14);3-6H,1-2H2 |
| EINECS |
248-337-4 |
| Molecular Structure |
|
| Boiling point |
296.1°C at 760 mmHg |
| Flash point |
134.1°C |
| Vapour Pressur |
0.000661mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
