ChemNet > CAS > 2737-22-6 3-Hydroxy-2,4,6-tribromobenzaldehyde
2737-22-6 3-Hydroxy-2,4,6-tribromobenzaldehyde
| product Name |
3-Hydroxy-2,4,6-tribromobenzaldehyde |
| CAS No |
2737-22-6 |
| Synonyms |
2,4,6-Tribromo-3-hydroxybenzaldehyde |
| Molecular Formula |
C7H3Br3O2 |
| Molecular Weight |
358.8095 |
| InChI |
InChI=1/C7H3Br3O2/c8-4-1-5(9)7(12)6(10)3(4)2-11/h1-2,12H |
| Molecular Structure |
|
| Density |
2.423g/cm3 |
| Boiling point |
305.9°C at 760 mmHg |
| Refractive index |
1.711 |
| Flash point |
138.8°C |
| Vapour Pressur |
0.00044mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
