ChemNet > CAS > 27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
| product Name |
2,5-Dimethyl-1,3,4-thiadiazole |
| CAS No |
27464-82-0 |
| Synonyms |
1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
| Molecular Formula |
C4H6N2S |
| Molecular Weight |
114.1688 |
| InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
| EINECS |
248-473-4 |
| Molecular Structure |
|
| Density |
1.166g/cm3 |
| Melting point |
62-65℃ |
| Boiling point |
202.5°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
81.2°C |
| Vapour Pressur |
0.415mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
