ChemNet > CAS > 27775-00-4 isononylamine, mixture of isomeric nonylamines
27775-00-4 isononylamine, mixture of isomeric nonylamines
| product Name |
isononylamine, mixture of isomeric nonylamines |
| CAS No |
27775-00-4 |
| Synonyms |
Isononylamine; 7-methyloctan-1-amine |
| Molecular Formula |
C9H21N |
| Molecular Weight |
143.2697 |
| InChI |
InChI=1/C9H21N/c1-9(2)7-5-3-4-6-8-10/h9H,3-8,10H2,1-2H3 |
| EINECS |
248-653-2 |
| Molecular Structure |
|
| Density |
0.79g/cm3 |
| Boiling point |
191°C at 760 mmHg |
| Refractive index |
1.434 |
| Flash point |
69.8°C |
| Vapour Pressur |
0.526mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
