ChemNet > CAS > 27829-72-7 ethyl trans-2-hexenoate
27829-72-7 ethyl trans-2-hexenoate
| product Name |
ethyl trans-2-hexenoate |
| CAS No |
27829-72-7 |
| Synonyms |
trans-2-Hexenoic acid ethyl ester; ethyl (2E)-hex-2-enoate; Ethyl (E)-Hex-2-Enoate |
| Molecular Formula |
C8H14O2 |
| Molecular Weight |
142.1956 |
| InChI |
InChI=1/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
| EINECS |
248-681-5 |
| Molecular Structure |
|
| Density |
0.901g/cm3 |
| Boiling point |
172.6°C at 760 mmHg |
| Refractive index |
1.432 |
| Flash point |
62.3°C |
| Vapour Pressur |
1.32mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
