ChemNet > CAS > 27960-21-0 3-Methyl-2-hexenoic acid (3:1 mixture of E and Z isomers)
27960-21-0 3-Methyl-2-hexenoic acid (3:1 mixture of E and Z isomers)
| product Name |
3-Methyl-2-hexenoic acid (3:1 mixture of E and Z isomers) |
| CAS No |
27960-21-0;35205-70-0 |
| Synonyms |
trans-3-Methyl-2-hexenoic acid; 3-Methyl-2-hexenoic acid; 2-Hexenoic acid, 3-methyl-, (E)-; (2E)-3-methylhex-2-enoic acid; 2-Hexenoic acid,3-methyl-, (2E)- |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-4-6(2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/b6-5+ |
| Molecular Structure |
|
| Density |
0.97g/cm3 |
| Boiling point |
225.2°C at 760 mmHg |
| Refractive index |
1.456 |
| Flash point |
132°C |
| Vapour Pressur |
0.0319mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
