ChemNet > CAS > 280556-71-0 (4-morpholinophenyl)methanol
280556-71-0 (4-morpholinophenyl)methanol
| product Name |
(4-morpholinophenyl)methanol |
| CAS No |
280556-71-0 |
| Synonyms |
(4-Morpholin-4-yl-phenyl)-methanol |
| Molecular Formula |
C11H15NO2 |
| Molecular Weight |
193.2423 |
| InChI |
InChI=1/C11H15NO2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
378.4°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
182.7°C |
| Vapour Pressur |
2.12E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
