ChemNet > CAS > 28098-03-5 octanoic acid, compound with 2-aminoethanol (1:1)
28098-03-5 octanoic acid, compound with 2-aminoethanol (1:1)
| product Name |
octanoic acid, compound with 2-aminoethanol (1:1) |
| CAS No |
28098-03-5 |
| Synonyms |
Octanoic acid, compd. with 2-aminoethanol (1:1); Caprylic acid, monoethanolamine salt; Monoethanolamine caprylate; Monoethanolamine octanoate; Octanoic acid, compound with 2-aminoethanol (1:1); octanoic acid - 2-aminoethanol (1:1) |
| Molecular Formula |
C10H23NO3 |
| Molecular Weight |
205.2945 |
| InChI |
InChI=1/C8H16O2.C2H7NO/c1-2-3-4-5-6-7-8(9)10;3-1-2-4/h2-7H2,1H3,(H,9,10);4H,1-3H2 |
| EINECS |
248-838-8 |
| Molecular Structure |
|
| Boiling point |
239.3°C at 760 mmHg |
| Flash point |
107.4°C |
| Vapour Pressur |
0.022mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
