ChemNet > CAS > 2816-24-2 2-Nitrophenyl-beta-D-glucopyranoside
2816-24-2 2-Nitrophenyl-beta-D-glucopyranoside
| product Name |
2-Nitrophenyl-beta-D-glucopyranoside |
| CAS No |
2816-24-2 |
| Synonyms |
2-Nitrophenyl beta-D-glucopyranoside; 2-Nitrophenyl beta-D-glucoside; NSC 1947; o-Nitrophenyl beta-D-glucopyranoside; o-Nitrophenyl beta-glucoside; Glucopyranoside, o-nitrophenyl, beta-D- (8CI); beta-D-Glucopyranoside, 2-nitrophenyl (9CI); 2-nitrophenyl alpha-D-glucopyranoside; 2-Nitrophenylβ-D-glucopyranoside |
| Molecular Formula |
C12H15NO8 |
| Molecular Weight |
301.2494 |
| InChI |
InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-4-2-1-3-6(7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12+/m1/s1 |
| EINECS |
220-568-5 |
| Molecular Structure |
|
| Density |
1.599g/cm3 |
| Boiling point |
572.39°C at 760 mmHg |
| Refractive index |
1.648 |
| Flash point |
299.971°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
