ChemNet > CAS > 28469-92-3 2,6-Dichlorostyrene
28469-92-3 2,6-Dichlorostyrene
| product Name |
2,6-Dichlorostyrene |
| CAS No |
28469-92-3 |
| Synonyms |
Benzene, 1,3-dichloro-2-ethenyl-; 1,3-dichloro-2-ethenylbenzene |
| Molecular Formula |
C8H6Cl2 |
| Molecular Weight |
173.0392 |
| InChI |
InChI=1/C8H6Cl2/c1-2-6-7(9)4-3-5-8(6)10/h2-5H,1H2 |
| EINECS |
249-039-7 |
| Molecular Structure |
|
| Density |
1.242g/cm3 |
| Boiling point |
222.4°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
93.9°C |
| Vapour Pressur |
0.151mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
