ChemNet > CAS > 2849-93-6 1H-benzimidazole-2-carboxylic acid
2849-93-6 1H-benzimidazole-2-carboxylic acid
| product Name |
1H-benzimidazole-2-carboxylic acid |
| CAS No |
2849-93-6 |
| Synonyms |
2-Benzimidazolecarboxylic acid |
| Molecular Formula |
C8H6N2O2 |
| Molecular Weight |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c11-8(12)7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10)(H,11,12) |
| Molecular Structure |
|
| Density |
1.507g/cm3 |
| Melting point |
169℃ |
| Boiling point |
443.991°C at 760 mmHg |
| Refractive index |
1.743 |
| Flash point |
222.318°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
