ChemNet > CAS > 287172-74-1 2-Chloro-3,6-difluorobenzoic acid
287172-74-1 2-Chloro-3,6-difluorobenzoic acid
| product Name |
2-Chloro-3,6-difluorobenzoic acid |
| CAS No |
287172-74-1 |
| Molecular Formula |
C7H3ClF2O2 |
| Molecular Weight |
192.5473 |
| InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
| Molecular Structure |
|
| Density |
1.573g/cm3 |
| Boiling point |
266.6°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
115°C |
| Vapour Pressur |
0.00427mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
