ChemNet > CAS > 2873-90-7 4-Diethylaminobenzonitrile
2873-90-7 4-Diethylaminobenzonitrile
| product Name |
4-Diethylaminobenzonitrile |
| CAS No |
2873-90-7 |
| Synonyms |
4-(Diethylamino)benzonitrile |
| Molecular Formula |
C11H14N2 |
| Molecular Weight |
174.2423 |
| InChI |
InChI=1/C11H14N2/c1-3-13(4-2)11-7-5-10(9-12)6-8-11/h5-8H,3-4H2,1-2H3 |
| EINECS |
220-712-7 |
| Molecular Structure |
|
| Density |
1.01g/cm3 |
| Boiling point |
341.8°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
151.4°C |
| Vapour Pressur |
7.85E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
