ChemNet > CAS > 28741-08-4 n-Octylboronic acid
28741-08-4 n-Octylboronic acid
| product Name |
n-Octylboronic acid |
| Synonyms |
Caprylboronic acid; n-Octaneboronic acid; octylboronic acid; 1-Octylboronic acid |
| Molecular Formula |
C8H19BO2 |
| Molecular Weight |
158.0463 |
| InChI |
InChI=1/C8H19BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-8H2,1H3 |
| CAS Registry Number |
28741-08-4 |
| Molecular Structure |
|
| Density |
0.89g/cm3 |
| Boiling point |
262.6°C at 760 mmHg |
| Refractive index |
1.427 |
| Flash point |
112.6°C |
| Vapour Pressur |
0.00153mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
