ChemNet > CAS > 28788-42-3 Decahydronaphthalene-d18
28788-42-3 Decahydronaphthalene-d18
| product Name |
Decahydronaphthalene-d18 |
| CAS No |
28788-42-3 |
| Synonyms |
Decahydronapthalene-d18; (~2~H_18_)decahydronaphthalene |
| Molecular Formula |
C10D18 |
| Molecular Weight |
156.3608 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D,10D |
| Molecular Structure |
|
| Density |
0.986g/cm3 |
| Melting point |
-32℃ |
| Boiling point |
190.9°C at 760 mmHg |
| Refractive index |
1.469 |
| Flash point |
57.2°C |
| Vapour Pressur |
0.735mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
