ChemNet > CAS > 287917-96-8 4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde
287917-96-8 4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde
| product Name |
4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde |
| CAS No |
287917-96-8 |
| Molecular Formula |
C5H5BrN2O |
| Molecular Weight |
189.01 |
| InChI |
InChI=1/C5H5BrN2O/c1-8-5(3-9)4(6)2-7-8/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.73g/cm3 |
| Melting point |
68℃ |
| Boiling point |
275.2°C at 760 mmHg |
| Refractive index |
1.621 |
| Flash point |
120.2°C |
| Vapour Pressur |
0.00517mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
