ChemNet > CAS > 2905-56-8 1-Benzylpiperidine
2905-56-8 1-Benzylpiperidine
| product Name |
1-Benzylpiperidine |
| CAS No |
2905-56-8 |
| Synonyms |
N-benzylpiperidine; 1-benzylpiperidine hydrochloride (1:1) |
| Molecular Formula |
C12H18ClN |
| Molecular Weight |
211.731 |
| InChI |
InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
| EINECS |
220-809-4 |
| Molecular Structure |
|
| Boiling point |
246.6°C at 760 mmHg |
| Flash point |
94°C |
| Vapour Pressur |
0.0269mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
