ChemNet > CAS > 2905-69-3 Methyl 2,5-dichlorobenzoate
2905-69-3 Methyl 2,5-dichlorobenzoate
| product Name |
Methyl 2,5-dichlorobenzoate |
| CAS No |
2905-69-3 |
| Synonyms |
2,5-Dichlorobenzoic acid methyl ester |
| Molecular Formula |
C8H6Cl2O2 |
| Molecular Weight |
205.038 |
| InChI |
InChI=1/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
| EINECS |
220-815-7 |
| Molecular Structure |
|
| Density |
1.355g/cm3 |
| Boiling point |
265.2°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
113.2°C |
| Vapour Pressur |
0.0093mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
