ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
| product Name |
Dimethyl phenylphosphonite |
| Synonyms |
Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
| Molecular Formula |
C8H11O2P |
| Molecular Weight |
170.1455 |
| InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| CAS Registry Number |
2946-61-4 |
| EINECS |
220-960-6 |
| Molecular Structure |
|
| Boiling point |
194.1°C at 760 mmHg |
| Flash point |
81°C |
| Vapour Pressur |
0.628mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
