ChemNet > CAS > 2958-87-4 2,3,6-Trichloroquinoxaline
2958-87-4 2,3,6-Trichloroquinoxaline
| product Name |
2,3,6-Trichloroquinoxaline |
| CAS No |
2958-87-4 |
| Synonyms |
Quinoxaline, 2,3,6-trichloro-; 4-23-00-01231 (Beilstein Handbook Reference); BRN 0007313; NSC 203052 |
| Molecular Formula |
C8H3Cl3N2 |
| Molecular Weight |
233.4818 |
| InChI |
InChI=1/C8H3Cl3N2/c9-4-1-2-5-6(3-4)13-8(11)7(10)12-5/h1-3H |
| EINECS |
220-987-3 |
| Molecular Structure |
|
| Density |
1.6g/cm3 |
| Melting point |
143-148℃ |
| Boiling point |
294.7°C at 760 mmHg |
| Refractive index |
1.677 |
| Flash point |
160°C |
| Vapour Pressur |
0.00281mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
