ChemNet > CAS > 2960-66-9 Ethyl trans-4-oxo-2-butenoate
2960-66-9 Ethyl trans-4-oxo-2-butenoate
| product Name |
Ethyl trans-4-oxo-2-butenoate |
| CAS No |
2960-66-9 |
| Synonyms |
Ethyl 3-formylacrylate; Ethyl fumaraldehydate; trans-4-Oxo-2-butenoic acid ethyl ester; 2-Butenoic acid,4-oxo-, ethyl ester, (2E)-; 2-Butenoicacid, 4-oxo-, ethyl ester, (E)-; Fumaraldehydic acid, ethyl ester; (2E)-4-Oxobut-2-enoic acid ethyl ester; (E)-4-Oxo-2-butenoicacid ethyl ester; (E)-Ethyl 4-oxo-2-butenoate; Ethyl (2E)-4-oxobut-2-enoate; Ethyl (E)-3-formylacrylate; Ethyltrans-4-oxo-2-butenoate; Ethyltrans-4-oxobutenoate |
| Molecular Formula |
C6H8O3 |
| Molecular Weight |
128.1259 |
| InChI |
InChI=1/C6H8O3/c1-2-9-6(8)4-3-5-7/h3-5H,2H2,1H3/b4-3+ |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Melting point |
-9 |
| Boiling point |
199.3°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
78.6°C |
| Vapour Pressur |
0.343mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R25:Toxic if swallowed.;
R34:Causes burns.;
R43:May cause sensitization by skin contact.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
