ChemNet > CAS > 29602-39-9 2-(2-Aminoethylamino)-5-nitropyridine
29602-39-9 2-(2-Aminoethylamino)-5-nitropyridine
| product Name |
2-(2-Aminoethylamino)-5-nitropyridine |
| CAS No |
29602-39-9 |
| Synonyms |
5-nitro-2-pyridylaminoethyl-2-amine; N-(5-nitropyridin-2-yl)ethane-1,2-diamine; 2-[(2-ammonioethyl)amino]-5-nitropyridinium |
| Molecular Formula |
C7H12N4O2 |
| Molecular Weight |
184.1947 |
| InChI |
InChI=1/C7H10N4O2/c8-3-4-9-7-2-1-6(5-10-7)11(12)13/h1-2,5H,3-4,8H2,(H,9,10)/p+2 |
| EINECS |
249-721-4 |
| Molecular Structure |
|
| Melting point |
126-128℃ |
| Boiling point |
382.4°C at 760 mmHg |
| Flash point |
185°C |
| Vapour Pressur |
4.75E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
