ChemNet > CAS > 29636-87-1 4-(Hydroxymethyl)-5-methylimidazole hydrochloride
29636-87-1 4-(Hydroxymethyl)-5-methylimidazole hydrochloride
| product Name |
4-(Hydroxymethyl)-5-methylimidazole hydrochloride |
| CAS No |
29636-87-1 |
| Synonyms |
5-methyl-1h-imidazole-4-methano |
| Molecular Formula |
C5H8N2O |
| Molecular Weight |
112.1298 |
| InChI |
InChI=1/C5H8N2O/c1-4-5(2-8)7-3-6-4/h3,8H,2H2,1H3,(H,6,7) |
| EINECS |
249-740-8 |
| Molecular Structure |
|
| Density |
1.231g/cm3 |
| Boiling point |
389.1°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
189.1°C |
| Vapour Pressur |
9.46E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
