ChemNet > CAS > 29682-39-1 1-Bromo-2-chloro-4-nitrobenzene
29682-39-1 1-Bromo-2-chloro-4-nitrobenzene
| product Name |
1-Bromo-2-chloro-4-nitrobenzene |
| CAS No |
29682-39-1 |
| Synonyms |
4-Bromo-3-chloronitrobenzene |
| Molecular Formula |
C6H3BrClNO2 |
| Molecular Weight |
236.4505 |
| InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| EINECS |
249-773-8 |
| Molecular Structure |
|
| Density |
1.827g/cm3 |
| Boiling point |
282.2°C at 760 mmHg |
| Refractive index |
1.618 |
| Flash point |
124.5°C |
| Vapour Pressur |
0.0058mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
