ChemNet > CAS > 29682-41-5 1,4-Dichloro-2-iodobenzene
29682-41-5 1,4-Dichloro-2-iodobenzene
| product Name |
1,4-Dichloro-2-iodobenzene |
| CAS No |
29682-41-5 |
| Synonyms |
2,5-Dichloroiodobenzene; ethyl 2-(methylsulfanyl)quinoline-1(2H)-carboxylate |
| Molecular Formula |
C6H3Cl2I |
| Molecular Weight |
272.8985 |
| InChI |
InChI=1/C6H3Cl2I/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| EINECS |
249-774-3 |
| Molecular Structure |
|
| Density |
2.015g/cm3 |
| Melting point |
21-257℃ |
| Boiling point |
255.5°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
93.9°C |
| Vapour Pressur |
0.026mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
