ChemNet > CAS > 29840-73-1 2-Bromopyridine-4-carboxamide
29840-73-1 2-Bromopyridine-4-carboxamide
| product Name |
2-Bromopyridine-4-carboxamide |
| CAS No |
29840-73-1 |
| Synonyms |
2-Bromoisonicotinamide |
| Molecular Formula |
C6H5BrN2O |
| Molecular Weight |
201.0207 |
| InChI |
InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| Molecular Structure |
|
| Density |
1.71g/cm3 |
| Boiling point |
338.1°C at 760 mmHg |
| Refractive index |
1.613 |
| Flash point |
158.3°C |
| Vapour Pressur |
0.0001mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
