ChemNet > CAS > 29881-14-9 1,2-Diphenylcyclopropane
29881-14-9 1,2-Diphenylcyclopropane
| product Name |
1,2-Diphenylcyclopropane |
| CAS No |
29881-14-9 |
| Synonyms |
1,1'-cyclopropane-1,2-diyldibenzene |
| Molecular Formula |
C15H14 |
| Molecular Weight |
194.2717 |
| InChI |
InChI=1/C15H14/c1-3-7-12(8-4-1)14-11-15(14)13-9-5-2-6-10-13/h1-10,14-15H,11H2 |
| EINECS |
214-511-3 |
| Molecular Structure |
|
| Density |
1.069g/cm3 |
| Boiling point |
290.6°C at 760 mmHg |
| Refractive index |
1.607 |
| Flash point |
130.8°C |
| Vapour Pressur |
0.00357mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
