ChemNet > CAS > 300-08-3 Arecoline hydrobromide
300-08-3 Arecoline hydrobromide
| product Name |
Arecoline hydrobromide |
| CAS No |
300-08-3 |
| Synonyms |
methyl 1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylate hydrobromide; methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide (1:1); 1-Methyl-1,2,5,6-tetrahydro-3-pyridinecarboxylic acid methyl ester hydrobromide; Arecoline HBr |
| Molecular Formula |
C8H14BrNO2 |
| Molecular Weight |
236.1063 |
| InChI |
InChI=1/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
| EINECS |
206-087-3 |
| Molecular Structure |
|
| Melting point |
171-174℃ |
| Boiling point |
209°C at 760 mmHg |
| Flash point |
81.1°C |
| Vapour Pressur |
0.208mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
