ChemNet > CAS > 300395-93-1 1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethan-1-one
300395-93-1 1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethan-1-one
| product Name |
1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethan-1-one |
| CAS No |
300395-93-1 |
| Synonyms |
1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethanone |
| Molecular Formula |
C13H13N3O4 |
| Molecular Weight |
275.26 |
| InChI |
InChI=1/C13H13N3O4/c1-9-14-13(16(18)19)8-15(9)7-12(17)10-3-5-11(20-2)6-4-10/h3-6,8H,7H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Melting point |
250℃ |
| Boiling point |
527.9°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
273.1°C |
| Vapour Pressur |
3.12E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
