ChemNet > CAS > 300541-91-7 4-morpholino-3-nitrobenzaldehyde
300541-91-7 4-morpholino-3-nitrobenzaldehyde
| product Name |
4-morpholino-3-nitrobenzaldehyde |
| CAS No |
300541-91-7 |
| Synonyms |
4-morpholin-4-yl-3-nitrobenzaldehyde |
| Molecular Formula |
C11H12N2O4 |
| Molecular Weight |
236.224 |
| InChI |
InChI=1/C11H12N2O4/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12/h1-2,7-8H,3-6H2 |
| Molecular Structure |
|
| Density |
1.34g/cm3 |
| Melting point |
53℃ |
| Boiling point |
431.6°C at 760 mmHg |
| Refractive index |
1.613 |
| Flash point |
214.8°C |
| Vapour Pressur |
1.18E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
