ChemNet > CAS > 300665-23-0 (4-morpholino-3-nitrophenyl)methanol hydrochloride
300665-23-0 (4-morpholino-3-nitrophenyl)methanol hydrochloride
| product Name |
(4-morpholino-3-nitrophenyl)methanol hydrochloride |
| CAS No |
300665-23-0 |
| Synonyms |
(4-morpholin-4-yl-3-nitrophenyl)methanol hydrochloride |
| Molecular Formula |
C11H15ClN2O4 |
| Molecular Weight |
274.7008 |
| InChI |
InChI=1/C11H14N2O4.ClH/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12;/h1-2,7,14H,3-6,8H2;1H |
| Molecular Structure |
|
| Melting point |
107℃ |
| Boiling point |
468.5°C at 760 mmHg |
| Flash point |
237.2°C |
| Vapour Pressur |
1.4E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
