ChemNet > CAS > 3007-23-6 1-(3-Methoxyphenyl)-1H-pyrrole-2,5-dione
3007-23-6 1-(3-Methoxyphenyl)-1H-pyrrole-2,5-dione
| product Name |
1-(3-Methoxyphenyl)-1H-pyrrole-2,5-dione |
| CAS No |
3007-23-6 |
| Synonyms |
1-(3-Methoxyphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione |
| Molecular Formula |
C11H9NO3 |
| Molecular Weight |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-15-9-4-2-3-8(7-9)12-10(13)5-6-11(12)14/h2-7H,1H3 |
| Molecular Structure |
|
| Density |
1.317g/cm3 |
| Melting point |
62℃ |
| Boiling point |
358.5°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
170.6°C |
| Vapour Pressur |
2.54E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
