ChemNet > CAS > 301-00-8 methyl linolenate
301-00-8 methyl linolenate
| product Name |
methyl linolenate |
| CAS No |
301-00-8 |
| Molecular Formula |
C19H32O2 |
| Molecular Weight |
292.4562 |
| InChI |
InChI=1/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b5-4-,8-7-,11-10- |
| EINECS |
206-102-3 |
| Molecular Structure |
|
| Density |
0.895g/cm3 |
| Boiling point |
364.4°C at 760 mmHg |
| Refractive index |
1.475 |
| Flash point |
101.4°C |
| Vapour Pressur |
1.69E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
