ChemNet > CAS > 3011-89-0 2-Chloro-4-nitrobenzamide
3011-89-0 2-Chloro-4-nitrobenzamide
| product Name |
2-Chloro-4-nitrobenzamide |
| CAS No |
3011-89-0 |
| Synonyms |
aklomide |
| Molecular Formula |
C7H5ClN2O3 |
| Molecular Weight |
200.5792 |
| InChI |
InChI=1/C7H5ClN2O3/c8-6-3-4(10(12)13)1-2-5(6)7(9)11/h1-3H,(H2,9,11) |
| EINECS |
221-143-7 |
| Molecular Structure |
|
| Density |
1.52g/cm3 |
| Boiling point |
335.8°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
156.9°C |
| Vapour Pressur |
0.000117mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
