ChemNet > CAS > 3016-97-5 1,4-Dibenzoylbenzene
3016-97-5 1,4-Dibenzoylbenzene
| product Name |
1,4-Dibenzoylbenzene |
| CAS No |
3016-97-5 |
| Synonyms |
4-Benzoylbenzophenone; benzene-1,4-diylbis(phenylmethanone) |
| Molecular Formula |
C20H14O2 |
| Molecular Weight |
286.324 |
| InChI |
InChI=1/C20H14O2/c21-19(15-7-3-1-4-8-15)17-11-13-18(14-12-17)20(22)16-9-5-2-6-10-16/h1-14H |
| EINECS |
221-155-2 |
| Molecular Structure |
|
| Density |
1.165g/cm3 |
| Melting point |
158-160℃ |
| Boiling point |
457.2°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
170.2°C |
| Vapour Pressur |
1.52E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
