ChemNet > CAS > 301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
| product Name |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid |
| CAS No |
301699-39-8 |
| Synonyms |
4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
| Molecular Formula |
C9H13BO3 |
| Molecular Weight |
180.0087 |
| InChI |
InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Melting point |
235-242℃ |
| Boiling point |
335.8°C at 760 mmHg |
| Refractive index |
1.517 |
| Flash point |
156.9°C |
| Vapour Pressur |
4.6E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
