ChemNet > CAS > 3019-25-8 cyclobutyl methyl ketone
3019-25-8 cyclobutyl methyl ketone
| product Name |
cyclobutyl methyl ketone |
| CAS No |
3019-25-8 |
| Synonyms |
Acetylcyclobutane; 1-cyclobutylethanone
; 1-cyclobutylethanone |
| Molecular Formula |
C6H10O |
| Molecular Weight |
98.143 |
| InChI |
InChI=1/C6H10O/c1-5(7)6-3-2-4-6/h6H,2-4H2,1H3 |
| EINECS |
221-163-6 |
| Molecular Structure |
|
| Density |
0.96g/cm3 |
| Boiling point |
137.5°C at 760 mmHg |
| Refractive index |
1.453 |
| Flash point |
32.3°C |
| Vapour Pressur |
7.02mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
