ChemNet > CAS > 3027-13-2 3-Methoxyphenylacetone
3027-13-2 3-Methoxyphenylacetone
| product Name |
3-Methoxyphenylacetone |
| CAS No |
3027-13-2 |
| Synonyms |
1-(3-Methoxyphenyl)-2-propanone; 1-(3-methoxyphenyl)propan-2-one |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(11)6-9-4-3-5-10(7-9)12-2/h3-5,7H,6H2,1-2H3 |
| EINECS |
221-191-9 |
| Molecular Structure |
|
| Density |
1.027g/cm3 |
| Boiling point |
259°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
102.7°C |
| Vapour Pressur |
0.0133mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
