3027-13-2 3-Methoxyphenylacetone
product Name |
3-Methoxyphenylacetone |
CAS No |
3027-13-2 |
Synonyms |
1-(3-Methoxyphenyl)-2-propanone; 1-(3-methoxyphenyl)propan-2-one |
Molecular Formula |
C10H12O2 |
Molecular Weight |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(11)6-9-4-3-5-10(7-9)12-2/h3-5,7H,6H2,1-2H3 |
EINECS |
221-191-9 |
Molecular Structure |
|
Density |
1.027g/cm3 |
Boiling point |
259°C at 760 mmHg |
Refractive index |
1.501 |
Flash point |
102.7°C |
Vapour Pressur |
0.0133mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|