ChemNet > CAS > 3029-40-1 1,8-Diphenyl-1,3,5,7-octatetraene
3029-40-1 1,8-Diphenyl-1,3,5,7-octatetraene
| product Name |
1,8-Diphenyl-1,3,5,7-octatetraene |
| CAS No |
3029-40-1 |
| Synonyms |
1,8-Diphenylocta-1,3,5,7-tetraene; 1,1'-octa-1,3,5,7-tetraene-1,8-diyldibenzene; 1,1'-(1E,3E,5E,7E)-octa-1,3,5,7-tetraene-1,8-diyldibenzene |
| Molecular Formula |
C20H18 |
| Molecular Weight |
258.3569 |
| InChI |
InChI=1/C20H18/c1(3-7-13-19-15-9-5-10-16-19)2-4-8-14-20-17-11-6-12-18-20/h1-18H/b3-1+,4-2+,13-7+,14-8+ |
| EINECS |
221-198-7 |
| Molecular Structure |
|
| Density |
1.023g/cm3 |
| Melting point |
235-237℃ |
| Boiling point |
444.9°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
250.2°C |
| Vapour Pressur |
1.08E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
